C10H15N3O3 — CID 104901222
(2R)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide (PubChem CID 104901222) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2R)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104901222 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2R)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)[C@H]2CCCN2)C(=O)N1 |
| InChI | InChI=1S/C10H15N3O3/c14-8-4-3-7(10(16)13-8)12-9(15)6-2-1-5-11-6/h6-7,11H,1-5H2,(H,12,15)(H,13,14,16)/t6-,7?/m1/s1 |
| InChIKey | ASCRKRVBNPVVOH-ULUSZKPHSA-N |
| XLogP | -1.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|