C22H44N2O2 — CID 177198123
3-[[(2E,4E)-5,6-dimethylnona-2,4-dien-2-yl]amino]piperidine-2,6-dione;ethane (PubChem CID 177198123) has the molecular formula C22H44N2O2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 3-[[(2E,4E)-5,6-dimethylnona-2,4-dien-2-yl]amino]piperidine-2,6-dione;ethane.
| Compound Name | 3-[[(2E,4E)-5,6-dimethylnona-2,4-dien-2-yl]amino]piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 177198123 |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | 3-[[(2E,4E)-5,6-dimethylnona-2,4-dien-2-yl]amino]piperidine-2,6-dione;ethane |
| SMILES | CC.CC.CC.CCCC(C)/C(C)=C/C=C(\C)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H26N2O2.3C2H6/c1-5-6-11(2)12(3)7-8-13(4)17-14-9-10-15(19)18-16(14)20;3*1-2/h7-8,11,14,17H,5-6,9-10H2,1-4H3,(H,18,19,20);3*1-2H3/b12-7+,13-8+;;; |
| InChIKey | CBMWRQHSMXAZMV-ONMLLRTDSA-N |
| XLogP | 5.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|