C9H13FN2O2 — CID 166865158
3-[[(Z)-3-fluoro-2-methylprop-2-enyl]amino]piperidine-2,6-dione (PubChem CID 166865158) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is 3-[[(Z)-3-fluoro-2-methylprop-2-enyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(Z)-3-fluoro-2-methylprop-2-enyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166865158 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-[[(Z)-3-fluoro-2-methylprop-2-enyl]amino]piperidine-2,6-dione |
| SMILES | C/C(=C/F)CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C9H13FN2O2/c1-6(4-10)5-11-7-2-3-8(13)12-9(7)14/h4,7,11H,2-3,5H2,1H3,(H,12,13,14)/b6-4- |
| InChIKey | KQEQBVFNIOIMBA-XQRVVYSFSA-N |
| XLogP | 0.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|