C18H21N3O4 — CID 146129255
N-(2,6-dioxopiperidin-3-yl)-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 146129255) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 146129255 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(c1ccccc1)N1CC(C(=O)NC2CCC(=O)NC2=O)CC1=O |
| InChI | InChI=1S/C18H21N3O4/c1-11(12-5-3-2-4-6-12)21-10-13(9-16(21)23)17(24)19-14-7-8-15(22)20-18(14)25/h2-6,11,13-14H,7-10H2,1H3,(H,19,24)(H,20,22,25) |
| InChIKey | WRYOFJQSZVGSPB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|