C20H25N3O4 — CID 154810817
1-(2,6-diethylphenyl)-N-(2,6-dioxopiperidin-3-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 154810817) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-N-(2,6-dioxopiperidin-3-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,6-diethylphenyl)-N-(2,6-dioxopiperidin-3-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154810817 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-(2,6-diethylphenyl)-N-(2,6-dioxopiperidin-3-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1cccc(CC)c1N1CC(C(=O)NC2CCC(=O)NC2=O)CC1=O |
| InChI | InChI=1S/C20H25N3O4/c1-3-12-6-5-7-13(4-2)18(12)23-11-14(10-17(23)25)19(26)21-15-8-9-16(24)22-20(15)27/h5-7,14-15H,3-4,8-11H2,1-2H3,(H,21,26)(H,22,24,27) |
| InChIKey | DFEKURJSBCMHKR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|