C22H24N2O4 — CID 9056341
3-[[(3R)-1-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoic acid (PubChem CID 9056341) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-[[(3R)-1-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[(3R)-1-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 9056341 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[[(3R)-1-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoic acid |
| SMILES | CCc1cccc(CC)c1N1C[C@H](C(=O)Nc2cccc(C(=O)O)c2)CC1=O |
| InChI | InChI=1S/C22H24N2O4/c1-3-14-7-5-8-15(4-2)20(14)24-13-17(12-19(24)25)21(26)23-18-10-6-9-16(11-18)22(27)28/h5-11,17H,3-4,12-13H2,1-2H3,(H,23,26)(H,27,28)/t17-/m1/s1 |
| InChIKey | RMQUWSOMFQIIGK-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |