C20H19N2O4- — CID 9004553
3-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 9004553) has the molecular formula C20H19N2O4- and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | 3-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 9004553 |
| Molecular Formula | C20H19N2O4- |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | CCc1ccccc1N1C[C@H](C(=O)Nc2cccc(C(=O)[O-])c2)CC1=O |
| InChI | InChI=1S/C20H20N2O4/c1-2-13-6-3-4-9-17(13)22-12-15(11-18(22)23)19(24)21-16-8-5-7-14(10-16)20(25)26/h3-10,15H,2,11-12H2,1H3,(H,21,24)(H,25,26)/p-1/t15-/m1/s1 |
| InChIKey | OWDUFYLCJWZEPN-OAHLLOKOSA-M |
| XLogP | 1.60 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |