C21H22N2O4 — CID 26098178
methyl 4-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 26098178) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 26098178 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl 4-[[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | CCc1ccccc1N1C[C@H](C(=O)Nc2ccc(C(=O)OC)cc2)CC1=O |
| InChI | InChI=1S/C21H22N2O4/c1-3-14-6-4-5-7-18(14)23-13-16(12-19(23)24)20(25)22-17-10-8-15(9-11-17)21(26)27-2/h4-11,16H,3,12-13H2,1-2H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | NHYSURAPWVGPFZ-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |