C20H20F2N2O2S — CID 112759119
N-[4-(difluoromethylsulfanyl)phenyl]-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 112759119) has the molecular formula C20H20F2N2O2S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112759119 |
| Molecular Formula | C20H20F2N2O2S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-(2-ethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccccc1N1CC(C(=O)Nc2ccc(SC(F)F)cc2)CC1=O |
| InChI | InChI=1S/C20H20F2N2O2S/c1-2-13-5-3-4-6-17(13)24-12-14(11-18(24)25)19(26)23-15-7-9-16(10-8-15)27-20(21)22/h3-10,14,20H,2,11-12H2,1H3,(H,23,26) |
| InChIKey | DWGXDBHMLDRDMG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |