C13H17N3O3S — CID 146124021
N-(2,6-dioxopiperidin-3-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 146124021) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 146124021 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(C)C)sc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H17N3O3S/c1-6(2)13-14-7(3)10(20-13)12(19)15-8-4-5-9(17)16-11(8)18/h6,8H,4-5H2,1-3H3,(H,15,19)(H,16,17,18) |
| InChIKey | XKMSEAHXNIQYIU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|