C14H18N4O — CID 47166966
N-tert-butyl-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 47166966) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-tert-butyl-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-tert-butyl-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47166966 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-tert-butyl-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)(C)C)cnn1-c1ccccn1 |
| InChI | InChI=1S/C14H18N4O/c1-10-11(13(19)17-14(2,3)4)9-16-18(10)12-7-5-6-8-15-12/h5-9H,1-4H3,(H,17,19) |
| InChIKey | VISWJSUXSZDVNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |