C15H14N6O2 — CID 78861089
5-methyl-1-pyridin-2-yl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide (PubChem CID 78861089) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-methyl-1-pyridin-2-yl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide.
| Compound Name | 5-methyl-1-pyridin-2-yl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78861089 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-methyl-1-pyridin-2-yl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc[nH]2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C15H14N6O2/c1-10-11(9-18-21(10)13-6-2-3-7-17-13)14(22)19-20-15(23)12-5-4-8-16-12/h2-9,16H,1H3,(H,19,22)(H,20,23) |
| InChIKey | IUDWZKWREDJHHE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|