C14H20N4O4 — CID 174087375
(3R)-N-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-piperazin-1-ylcyclobutene-1-carboxamide (PubChem CID 174087375) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (3R)-N-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-piperazin-1-ylcyclobutene-1-carboxamide.
| Compound Name | (3R)-N-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-piperazin-1-ylcyclobutene-1-carboxamide |
|---|---|
| PubChem CID | 174087375 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (3R)-N-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-piperazin-1-ylcyclobutene-1-carboxamide |
| SMILES | O=C1CCC(NC(=O)C2=C(O)[C@H](N3CCNCC3)C2)C(=O)N1 |
| InChI | InChI=1S/C14H20N4O4/c19-11-2-1-9(14(22)17-11)16-13(21)8-7-10(12(8)20)18-5-3-15-4-6-18/h9-10,15,20H,1-7H2,(H,16,21)(H,17,19,22)/t9?,10-/m1/s1 |
| InChIKey | SFMROCBAUARUBC-QVDQXJPCSA-N |
| XLogP | -1.60 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|