C19H18F2N2O4 — CID 177209232
1-[4-[2,6-bis(oxomethylidene)piperidin-3-yl]-3,5-difluorophenyl]piperidine-4-carboxylic acid (PubChem CID 177209232) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 1-[4-[2,6-bis(oxomethylidene)piperidin-3-yl]-3,5-difluorophenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[2,6-bis(oxomethylidene)piperidin-3-yl]-3,5-difluorophenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 177209232 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[4-[2,6-bis(oxomethylidene)piperidin-3-yl]-3,5-difluorophenyl]piperidine-4-carboxylic acid |
| SMILES | O=C=C1CCC(c2c(F)cc(N3CCC(C(=O)O)CC3)cc2F)C(=C=O)N1 |
| InChI | InChI=1S/C19H18F2N2O4/c20-15-7-13(23-5-3-11(4-6-23)19(26)27)8-16(21)18(15)14-2-1-12(9-24)22-17(14)10-25/h7-8,11,14,22H,1-6H2,(H,26,27) |
| InChIKey | WLUVAWPQSGUPFE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|