C21H26F2N4O4 — CID 176869474
piperidin-1-ylmethyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate (PubChem CID 176869474) has the molecular formula C21H26F2N4O4 and a molecular weight of 436.46 g/mol. Its IUPAC name is piperidin-1-ylmethyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate.
| Compound Name | piperidin-1-ylmethyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 176869474 |
| Molecular Formula | C21H26F2N4O4 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | piperidin-1-ylmethyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
| SMILES | O=C1CCC(c2c(F)cc(N3CC(NC(=O)OCN4CCCCC4)C3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C21H26F2N4O4/c22-16-8-14(9-17(23)19(16)15-4-5-18(28)25-20(15)29)27-10-13(11-27)24-21(30)31-12-26-6-2-1-3-7-26/h8-9,13,15H,1-7,10-12H2,(H,24,30)(H,25,28,29) |
| InChIKey | YZOLBADTMAOGRN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|