C25H32F2N4O3 — CID 171540940
[(E)-1-cyclopropylhex-3-en-3-yl] N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-N'-methylcarbamimidate (PubChem CID 171540940) has the molecular formula C25H32F2N4O3 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(E)-1-cyclopropylhex-3-en-3-yl] N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-N'-methylcarbamimidate.
| Compound Name | [(E)-1-cyclopropylhex-3-en-3-yl] N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-N'-methylcarbamimidate |
|---|---|
| PubChem CID | 171540940 |
| Molecular Formula | C25H32F2N4O3 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(E)-1-cyclopropylhex-3-en-3-yl] N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-N'-methylcarbamimidate |
| SMILES | CC/C=C(\CCC1CC1)O/C(=N\C)NC1CN(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)C1 |
| InChI | InChI=1S/C25H32F2N4O3/c1-3-4-18(8-7-15-5-6-15)34-25(28-2)29-16-13-31(14-16)17-11-20(26)23(21(27)12-17)19-9-10-22(32)30-24(19)33/h4,11-12,15-16,19H,3,5-10,13-14H2,1-2H3,(H,28,29)(H,30,32,33)/b18-4+ |
| InChIKey | PSRPUEJZTWRDMC-JJPRUIFNSA-N |
| XLogP | 3.75 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|