C20H28F2N2O3Si — CID 172616861
3-[4-[3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione (PubChem CID 172616861) has the molecular formula C20H28F2N2O3Si and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172616861 |
| Molecular Formula | C20H28F2N2O3Si |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[4-[3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)C1 |
| InChI | InChI=1S/C20H28F2N2O3Si/c1-20(2,3)28(4,5)27-13-10-24(11-13)12-8-15(21)18(16(22)9-12)14-6-7-17(25)23-19(14)26/h8-9,13-14H,6-7,10-11H2,1-5H3,(H,23,25,26) |
| InChIKey | FQCBZZBREXUYJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|