C18H20F2N2O3 — CID 166947439
2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]acetaldehyde (PubChem CID 166947439) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]acetaldehyde.
| Compound Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 166947439 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]piperidin-4-yl]acetaldehyde |
| SMILES | O=CCC1CCN(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C18H20F2N2O3/c19-14-9-12(22-6-3-11(4-7-22)5-8-23)10-15(20)17(14)13-1-2-16(24)21-18(13)25/h8-11,13H,1-7H2,(H,21,24,25) |
| InChIKey | DIAWUSCQCARXIQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|