C15H15F2N3O3 — CID 171541033
3-[4-[(4R)-4-amino-2-oxopyrrolidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione (PubChem CID 171541033) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is 3-[4-[(4R)-4-amino-2-oxopyrrolidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[(4R)-4-amino-2-oxopyrrolidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171541033 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-[4-[(4R)-4-amino-2-oxopyrrolidin-1-yl]-2,6-difluorophenyl]piperidine-2,6-dione |
| SMILES | N[C@@H]1CC(=O)N(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)C1 |
| InChI | InChI=1S/C15H15F2N3O3/c16-10-4-8(20-6-7(18)3-13(20)22)5-11(17)14(10)9-1-2-12(21)19-15(9)23/h4-5,7,9H,1-3,6,18H2,(H,19,21,23)/t7-,9?/m1/s1 |
| InChIKey | LZRANQRRCCUHGI-YOXFSPIKSA-N |
| XLogP | 0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|