C20H25F3N4O2 — CID 170185699
3-[2,6-difluoro-4-[(3S,4S)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 170185699) has the molecular formula C20H25F3N4O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[(3S,4S)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2,6-difluoro-4-[(3S,4S)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170185699 |
| Molecular Formula | C20H25F3N4O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-[2,6-difluoro-4-[(3S,4S)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2c(F)cc(N3CC[C@H](N4CCNCC4)[C@@H](F)C3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C20H25F3N4O2/c21-14-9-12(10-15(22)19(14)13-1-2-18(28)25-20(13)29)27-6-3-17(16(23)11-27)26-7-4-24-5-8-26/h9-10,13,16-17,24H,1-8,11H2,(H,25,28,29)/t13?,16-,17-/m0/s1 |
| InChIKey | MMEODPWVUPKXAZ-LMARGRMVSA-N |
| XLogP | 1.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|