C20H27F2N5O2 — CID 172616814
3-[3-fluoro-5-[(3S,4R)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]-6-methyl-2-pyridinyl]piperidine-2,6-dione (PubChem CID 172616814) has the molecular formula C20H27F2N5O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[3-fluoro-5-[(3S,4R)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]-6-methyl-2-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-5-[(3S,4R)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]-6-methyl-2-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172616814 |
| Molecular Formula | C20H27F2N5O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-[3-fluoro-5-[(3S,4R)-3-fluoro-4-piperazin-1-ylpiperidin-1-yl]-6-methyl-2-pyridinyl]piperidine-2,6-dione |
| SMILES | Cc1nc(C2CCC(=O)NC2=O)c(F)cc1N1CC[C@@H](N2CCNCC2)[C@@H](F)C1 |
| InChI | InChI=1S/C20H27F2N5O2/c1-12-17(10-14(21)19(24-12)13-2-3-18(28)25-20(13)29)27-7-4-16(15(22)11-27)26-8-5-23-6-9-26/h10,13,15-16,23H,2-9,11H2,1H3,(H,25,28,29)/t13?,15-,16+/m0/s1 |
| InChIKey | IVDKOMICECSIJN-PXWJKWRZSA-N |
| XLogP | 0.87 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|