C25H32F2N4O5 — CID 170185752
tert-butyl 4-[4-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]-2-oxopiperazin-1-yl]piperidine-1-carboxylate (PubChem CID 170185752) has the molecular formula C25H32F2N4O5 and a molecular weight of 506.55 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]-2-oxopiperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]-2-oxopiperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170185752 |
| Molecular Formula | C25H32F2N4O5 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | tert-butyl 4-[4-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]-2-oxopiperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCN(c3cc(F)c(C4CCC(=O)NC4=O)c(F)c3)CC2=O)CC1 |
| InChI | InChI=1S/C25H32F2N4O5/c1-25(2,3)36-24(35)29-8-6-15(7-9-29)31-11-10-30(14-21(31)33)16-12-18(26)22(19(27)13-16)17-4-5-20(32)28-23(17)34/h12-13,15,17H,4-11,14H2,1-3H3,(H,28,32,34) |
| InChIKey | HEIFCEWXDLNOMQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|