C21H27F2N3O4 — CID 171541076
2-methylpentyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate (PubChem CID 171541076) has the molecular formula C21H27F2N3O4 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-methylpentyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate.
| Compound Name | 2-methylpentyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171541076 |
| Molecular Formula | C21H27F2N3O4 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-methylpentyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
| SMILES | CCCC(C)COC(=O)NC1CN(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)C1 |
| InChI | InChI=1S/C21H27F2N3O4/c1-3-4-12(2)11-30-21(29)24-13-9-26(10-13)14-7-16(22)19(17(23)8-14)15-5-6-18(27)25-20(15)28/h7-8,12-13,15H,3-6,9-11H2,1-2H3,(H,24,29)(H,25,27,28) |
| InChIKey | RRTRXSCLZOMHKS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|