C14H15ClN2O2 — CID 174105700
(3S)-3-[4-(azetidin-1-yl)-2-chlorophenyl]piperidine-2,6-dione (PubChem CID 174105700) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (3S)-3-[4-(azetidin-1-yl)-2-chlorophenyl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[4-(azetidin-1-yl)-2-chlorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174105700 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (3S)-3-[4-(azetidin-1-yl)-2-chlorophenyl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](c2ccc(N3CCC3)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-12-8-9(17-6-1-7-17)2-3-10(12)11-4-5-13(18)16-14(11)19/h2-3,8,11H,1,4-7H2,(H,16,18,19)/t11-/m0/s1 |
| InChIKey | MLOLUIQCGWBVAG-NSHDSACASA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|