C19H25N5O2 — CID 172587109
3-[1-methyl-7-[methyl(piperidin-4-yl)amino]indazol-3-yl]piperidine-2,6-dione (PubChem CID 172587109) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[1-methyl-7-[methyl(piperidin-4-yl)amino]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[methyl(piperidin-4-yl)amino]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172587109 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[1-methyl-7-[methyl(piperidin-4-yl)amino]indazol-3-yl]piperidine-2,6-dione |
| SMILES | CN(c1cccc2c(C3CCC(=O)NC3=O)nn(C)c12)C1CCNCC1 |
| InChI | InChI=1S/C19H25N5O2/c1-23(12-8-10-20-11-9-12)15-5-3-4-13-17(22-24(2)18(13)15)14-6-7-16(25)21-19(14)26/h3-5,12,14,20H,6-11H2,1-2H3,(H,21,25,26) |
| InChIKey | TXWJSPHTBCSJJF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|