C15H15F3N4O2 — CID 170023276
3-[7-amino-1-(1,1,1-trifluoropropan-2-yl)indazol-3-yl]piperidine-2,6-dione (PubChem CID 170023276) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is 3-[7-amino-1-(1,1,1-trifluoropropan-2-yl)indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-amino-1-(1,1,1-trifluoropropan-2-yl)indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170023276 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[7-amino-1-(1,1,1-trifluoropropan-2-yl)indazol-3-yl]piperidine-2,6-dione |
| SMILES | CC(n1nc(C2CCC(=O)NC2=O)c2cccc(N)c21)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O2/c1-7(15(16,17)18)22-13-8(3-2-4-10(13)19)12(21-22)9-5-6-11(23)20-14(9)24/h2-4,7,9H,5-6,19H2,1H3,(H,20,23,24) |
| InChIKey | MAQJDXGYDKAEET-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|