C22H29ClFN5O3 — CID 166514379
N-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzamide (PubChem CID 166514379) has the molecular formula C22H29ClFN5O3 and a molecular weight of 465.96 g/mol. Its IUPAC name is N-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzamide.
| Compound Name | N-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 166514379 |
| Molecular Formula | C22H29ClFN5O3 |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[4-(piperazin-1-ylmethyl)piperidin-1-yl]benzamide |
| SMILES | O=C1CCC(N(Cl)C(=O)c2cccc(N3CCC(CN4CCNCC4)CC3)c2F)C(=O)N1 |
| InChI | InChI=1S/C22H29ClFN5O3/c23-29(18-4-5-19(30)26-21(18)31)22(32)16-2-1-3-17(20(16)24)28-10-6-15(7-11-28)14-27-12-8-25-9-13-27/h1-3,15,18,25H,4-14H2,(H,26,30,31) |
| InChIKey | ACODOESVNRZZNC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|