C22H31ClN6O4 — CID 175537818
[4-[[4-[2-chloro-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]methyl]piperidin-1-yl] carbamate (PubChem CID 175537818) has the molecular formula C22H31ClN6O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is [4-[[4-[2-chloro-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]methyl]piperidin-1-yl] carbamate.
| Compound Name | [4-[[4-[2-chloro-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]methyl]piperidin-1-yl] carbamate |
|---|---|
| PubChem CID | 175537818 |
| Molecular Formula | C22H31ClN6O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [4-[[4-[2-chloro-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]methyl]piperidin-1-yl] carbamate |
| SMILES | NC(=O)ON1CCC(CN2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C22H31ClN6O4/c23-17-13-16(25-18-2-4-20(30)26-21(18)31)1-3-19(17)28-11-9-27(10-12-28)14-15-5-7-29(8-6-15)33-22(24)32/h1,3,13,15,18,25H,2,4-12,14H2,(H2,24,32)(H,26,30,31) |
| InChIKey | YJGQYWKPVBOGCN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|