C24H33F2N5O4 — CID 177160644
3-[3,5-difluoro-4-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]methyl]piperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 177160644) has the molecular formula C24H33F2N5O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]methyl]piperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3,5-difluoro-4-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]methyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177160644 |
| Molecular Formula | C24H33F2N5O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 3-[3,5-difluoro-4-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]methyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COCC(=O)N1CCC(CN2CCN(c3c(F)cc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C24H33F2N5O4/c1-35-15-22(33)30-6-4-16(5-7-30)14-29-8-10-31(11-9-29)23-18(25)12-17(13-19(23)26)27-20-2-3-21(32)28-24(20)34/h12-13,16,20,27H,2-11,14-15H2,1H3,(H,28,32,34) |
| InChIKey | ZOYROMBJIPBANJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|