C23H30F2N4O4 — CID 177160328
7-[2-[4-[(2,6-dioxopiperidin-3-yl)amino]-2,6-difluorophenyl]-2,6-diazaspiro[3.3]heptan-6-yl]heptanoic acid (PubChem CID 177160328) has the molecular formula C23H30F2N4O4 and a molecular weight of 464.51 g/mol. Its IUPAC name is 7-[2-[4-[(2,6-dioxopiperidin-3-yl)amino]-2,6-difluorophenyl]-2,6-diazaspiro[3.3]heptan-6-yl]heptanoic acid.
| Compound Name | 7-[2-[4-[(2,6-dioxopiperidin-3-yl)amino]-2,6-difluorophenyl]-2,6-diazaspiro[3.3]heptan-6-yl]heptanoic acid |
|---|---|
| PubChem CID | 177160328 |
| Molecular Formula | C23H30F2N4O4 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 7-[2-[4-[(2,6-dioxopiperidin-3-yl)amino]-2,6-difluorophenyl]-2,6-diazaspiro[3.3]heptan-6-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1CC2(C1)CN(c1c(F)cc(NC3CCC(=O)NC3=O)cc1F)C2 |
| InChI | InChI=1S/C23H30F2N4O4/c24-16-9-15(26-18-6-7-19(30)27-22(18)33)10-17(25)21(16)29-13-23(14-29)11-28(12-23)8-4-2-1-3-5-20(31)32/h9-10,18,26H,1-8,11-14H2,(H,31,32)(H,27,30,33) |
| InChIKey | XIAOKFFHKUJFSV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|