C33H54FN5O6 — CID 177044299
tert-butyl 4-[6-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]hexyl]piperazine-1-carboxylate;ethane (PubChem CID 177044299) has the molecular formula C33H54FN5O6 and a molecular weight of 635.82 g/mol. Its IUPAC name is tert-butyl 4-[6-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]hexyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[6-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]hexyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 177044299 |
| Molecular Formula | C33H54FN5O6 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.41 |
| IUPAC Name | tert-butyl 4-[6-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]hexyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(CCCCCCN(C(=O)OC(C)(C)C)c2ccc(NC3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C31H48FN5O6.C2H6/c1-30(2,3)42-28(40)36-19-17-35(18-20-36)15-9-7-8-10-16-37(29(41)43-31(4,5)6)25-13-11-22(21-23(25)32)33-24-12-14-26(38)34-27(24)39;1-2/h11,13,21,24,33H,7-10,12,14-20H2,1-6H3,(H,34,38,39);1-2H3 |
| InChIKey | NRPXEMIPRQFVCZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|