C18H21F2N3O4 — CID 166899983
2-[(4S)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-3,3-difluoropiperidin-1-yl]acetic acid (PubChem CID 166899983) has the molecular formula C18H21F2N3O4 and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-[(4S)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-3,3-difluoropiperidin-1-yl]acetic acid.
| Compound Name | 2-[(4S)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-3,3-difluoropiperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 166899983 |
| Molecular Formula | C18H21F2N3O4 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[(4S)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-3,3-difluoropiperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CC[C@@H](c2ccc(NC3CCC(=O)NC3=O)cc2)C(F)(F)C1 |
| InChI | InChI=1S/C18H21F2N3O4/c19-18(20)10-23(9-16(25)26)8-7-13(18)11-1-3-12(4-2-11)21-14-5-6-15(24)22-17(14)27/h1-4,13-14,21H,5-10H2,(H,25,26)(H,22,24,27)/t13-,14?/m0/s1 |
| InChIKey | ORHWOOUNLSMADP-LSLKUGRBSA-N |
| XLogP | 1.41 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|