C15H21N5O4 — CID 166899719
2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]pyrazol-1-yl]piperidin-1-yl]acetic acid (PubChem CID 166899719) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]pyrazol-1-yl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]pyrazol-1-yl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 166899719 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]pyrazol-1-yl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(n2cc(NC3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C15H21N5O4/c21-13-2-1-12(15(24)18-13)17-10-7-16-20(8-10)11-3-5-19(6-4-11)9-14(22)23/h7-8,11-12,17H,1-6,9H2,(H,22,23)(H,18,21,24) |
| InChIKey | WQAVJFAVUYNWNO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|