C22H30FN5O3 — CID 167190155
N-[(3S)-2,6-dioxopiperidin-3-yl]-5-[4-[[(3S)-3-fluoropiperidin-1-yl]methyl]piperidin-1-yl]pyridine-2-carboxamide (PubChem CID 167190155) has the molecular formula C22H30FN5O3 and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]-5-[4-[[(3S)-3-fluoropiperidin-1-yl]methyl]piperidin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-5-[4-[[(3S)-3-fluoropiperidin-1-yl]methyl]piperidin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167190155 |
| Molecular Formula | C22H30FN5O3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-5-[4-[[(3S)-3-fluoropiperidin-1-yl]methyl]piperidin-1-yl]pyridine-2-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ccc(N3CCC(CN4CCC[C@H](F)C4)CC3)cn2)C(=O)N1 |
| InChI | InChI=1S/C22H30FN5O3/c23-16-2-1-9-27(14-16)13-15-7-10-28(11-8-15)17-3-4-18(24-12-17)21(30)25-19-5-6-20(29)26-22(19)31/h3-4,12,15-16,19H,1-2,5-11,13-14H2,(H,25,30)(H,26,29,31)/t16-,19-/m0/s1 |
| InChIKey | MWEDKLWFCIIHTE-LPHOPBHVSA-N |
| XLogP | 1.27 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|