C25H34N4O3 — CID 177194822
3-[[3-oxo-6-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-1,2-dihydroinden-2-yl]methyl]piperidine-2,6-dione (PubChem CID 177194822) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[[3-oxo-6-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-1,2-dihydroinden-2-yl]methyl]piperidine-2,6-dione.
| Compound Name | 3-[[3-oxo-6-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-1,2-dihydroinden-2-yl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177194822 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 3-[[3-oxo-6-[4-(piperidin-4-ylmethyl)piperazin-1-yl]-1,2-dihydroinden-2-yl]methyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CC2Cc3cc(N4CCN(CC5CCNCC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H34N4O3/c30-23-4-1-18(25(32)27-23)13-20-14-19-15-21(2-3-22(19)24(20)31)29-11-9-28(10-12-29)16-17-5-7-26-8-6-17/h2-3,15,17-18,20,26H,1,4-14,16H2,(H,27,30,32) |
| InChIKey | MHZQRKBAHMPLBG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|