C32H41N5O4 — CID 167463597
benzyl N-[7-[[1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate (PubChem CID 167463597) has the molecular formula C32H41N5O4 and a molecular weight of 559.71 g/mol. Its IUPAC name is benzyl N-[7-[[1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate.
| Compound Name | benzyl N-[7-[[1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 167463597 |
| Molecular Formula | C32H41N5O4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | benzyl N-[7-[[1-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidin-4-yl]methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
| SMILES | O=C1CCN(c2ccc(N3CCC(CN4CCC5(CC4)CC(NC(=O)OCc4ccccc4)C5)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C32H41N5O4/c38-29-12-17-37(30(39)34-29)28-8-6-27(7-9-28)36-15-10-24(11-16-36)22-35-18-13-32(14-19-35)20-26(21-32)33-31(40)41-23-25-4-2-1-3-5-25/h1-9,24,26H,10-23H2,(H,33,40)(H,34,38,39) |
| InChIKey | LECCWSCHNPJSQK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|