C22H33N3O3 — CID 167463483
benzyl N-[7-[(4-hydroxypiperidin-4-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate (PubChem CID 167463483) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is benzyl N-[7-[(4-hydroxypiperidin-4-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate.
| Compound Name | benzyl N-[7-[(4-hydroxypiperidin-4-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 167463483 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | benzyl N-[7-[(4-hydroxypiperidin-4-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]carbamate |
| SMILES | O=C(NC1CC2(CCN(CC3(O)CCNCC3)CC2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C22H33N3O3/c26-20(28-16-18-4-2-1-3-5-18)24-19-14-21(15-19)8-12-25(13-9-21)17-22(27)6-10-23-11-7-22/h1-5,19,23,27H,6-17H2,(H,24,26) |
| InChIKey | ZGHJQZMJFAMEFL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |