C21H30N2O2 — CID 155875097
cyclopentyl N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)carbamate (PubChem CID 155875097) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is cyclopentyl N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)carbamate.
| Compound Name | cyclopentyl N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)carbamate |
|---|---|
| PubChem CID | 155875097 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | cyclopentyl N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)carbamate |
| SMILES | O=C(NC1CC2(CCN(Cc3ccccc3)CC2)C1)OC1CCCC1 |
| InChI | InChI=1S/C21H30N2O2/c24-20(25-19-8-4-5-9-19)22-18-14-21(15-18)10-12-23(13-11-21)16-17-6-2-1-3-7-17/h1-3,6-7,18-19H,4-5,8-16H2,(H,22,24) |
| InChIKey | BKDIVNTVSZOJGK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |