C21H26N2O2S — CID 155880238
N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)benzenesulfonamide (PubChem CID 155880238) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)benzenesulfonamide.
| Compound Name | N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 155880238 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(7-benzyl-7-azaspiro[3.5]nonan-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC2(CCN(Cc3ccccc3)CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2S/c24-26(25,20-9-5-2-6-10-20)22-19-15-21(16-19)11-13-23(14-12-21)17-18-7-3-1-4-8-18/h1-10,19,22H,11-17H2 |
| InChIKey | BGXHWEHYCUXNPU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |