C20H28N4O4 — CID 167190325
N-[2-(dimethylamino)-4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide (PubChem CID 167190325) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide.
| Compound Name | N-[2-(dimethylamino)-4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 167190325 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[2-(dimethylamino)-4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-N-(2,6-dioxopiperidin-3-yl)formamide |
| SMILES | CN(C)c1cc(N2CCC(CO)CC2)ccc1N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H28N4O4/c1-22(2)18-11-15(23-9-7-14(12-25)8-10-23)3-4-16(18)24(13-26)17-5-6-19(27)21-20(17)28/h3-4,11,13-14,17,25H,5-10,12H2,1-2H3,(H,21,27,28) |
| InChIKey | OJBHLHHNCXWABO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|