C17H23N3O3 — CID 166948250
1-[4-[4-(hydroxymethyl)piperidin-1-yl]-3-methylphenyl]-1,3-diazinane-2,4-dione (PubChem CID 166948250) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[4-[4-(hydroxymethyl)piperidin-1-yl]-3-methylphenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-(hydroxymethyl)piperidin-1-yl]-3-methylphenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 166948250 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[4-[4-(hydroxymethyl)piperidin-1-yl]-3-methylphenyl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc(N2CCC(=O)NC2=O)ccc1N1CCC(CO)CC1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-10-14(20-9-6-16(22)18-17(20)23)2-3-15(12)19-7-4-13(11-21)5-8-19/h2-3,10,13,21H,4-9,11H2,1H3,(H,18,22,23) |
| InChIKey | BZIZNTWNBXHYGV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|