C28H36N6O4 — CID 177364685
1-[2-methyl-4-[4-[[1-(2-methyl-4-nitrophenyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 177364685) has the molecular formula C28H36N6O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-[2-methyl-4-[4-[[1-(2-methyl-4-nitrophenyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-methyl-4-[4-[[1-(2-methyl-4-nitrophenyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177364685 |
| Molecular Formula | C28H36N6O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 1-[2-methyl-4-[4-[[1-(2-methyl-4-nitrophenyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1CCC(CN2CCN(c3ccc(N4CCC(=O)NC4=O)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C28H36N6O4/c1-20-18-24(34(37)38)4-5-25(20)32-10-7-22(8-11-32)19-30-13-15-31(16-14-30)23-3-6-26(21(2)17-23)33-12-9-27(35)29-28(33)36/h3-6,17-18,22H,7-16,19H2,1-2H3,(H,29,35,36) |
| InChIKey | GVIDRICQQFTOIB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|