C33H41N7O5 — CID 177362770
3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[[4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 177362770) has the molecular formula C33H41N7O5 and a molecular weight of 615.74 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[[4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[[4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177362770 |
| Molecular Formula | C33H41N7O5 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[[4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3ccc(N4CCC(CN5CCC(n6cc([N+](=O)[O-])cn6)CC5)CC4)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C33H41N7O5/c1-24-19-28(5-8-31(24)37-18-13-32(41)38(33(37)42)22-25-3-6-30(45-2)7-4-25)36-16-9-26(10-17-36)21-35-14-11-27(12-15-35)39-23-29(20-34-39)40(43)44/h3-8,19-20,23,26-27H,9-18,21-22H2,1-2H3 |
| InChIKey | MLHYBNAUVVHLCZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 117.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|