C33H40FN7O5 — CID 177362961
1-[4-[4-[[(3S,4R)-3-fluoro-4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 177362961) has the molecular formula C33H40FN7O5 and a molecular weight of 633.73 g/mol. Its IUPAC name is 1-[4-[4-[[(3S,4R)-3-fluoro-4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-[[(3S,4R)-3-fluoro-4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177362961 |
| Molecular Formula | C33H40FN7O5 |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 1-[4-[4-[[(3S,4R)-3-fluoro-4-(4-nitropyrazol-1-yl)piperidin-1-yl]methyl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3ccc(N4CCC(CN5CC[C@@H](n6cc([N+](=O)[O-])cn6)[C@@H](F)C5)CC4)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C33H40FN7O5/c1-23-17-26(5-8-30(23)38-16-12-32(42)39(33(38)43)20-24-3-6-28(46-2)7-4-24)37-14-9-25(10-15-37)19-36-13-11-31(29(34)22-36)40-21-27(18-35-40)41(44)45/h3-8,17-18,21,25,29,31H,9-16,19-20,22H2,1-2H3/t29-,31+/m0/s1 |
| InChIKey | XGYKNLNRWAZZOM-IGYGKHONSA-N |
| XLogP | 4.97 |
| TPSA | 117.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|