C35H43N5O3 — CID 177363708
1-[4-[4-[4-(4-aminophenyl)piperidin-1-yl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 177363708) has the molecular formula C35H43N5O3 and a molecular weight of 581.76 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-aminophenyl)piperidin-1-yl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-[4-(4-aminophenyl)piperidin-1-yl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177363708 |
| Molecular Formula | C35H43N5O3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | 1-[4-[4-[4-(4-aminophenyl)piperidin-1-yl]piperidin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3ccc(N4CCC(N5CCC(c6ccc(N)cc6)CC5)CC4)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C35H43N5O3/c1-25-23-31(38-20-15-30(16-21-38)37-18-13-28(14-19-37)27-5-7-29(36)8-6-27)9-12-33(25)39-22-17-34(41)40(35(39)42)24-26-3-10-32(43-2)11-4-26/h3-12,23,28,30H,13-22,24,36H2,1-2H3 |
| InChIKey | YCXIMLHTZMAMSW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|