C35H41N5O5 — CID 177363167
3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[1-(4-nitrophenyl)piperidin-4-yl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 177363167) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[1-(4-nitrophenyl)piperidin-4-yl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[1-(4-nitrophenyl)piperidin-4-yl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177363167 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1-[2-methyl-4-[4-[1-(4-nitrophenyl)piperidin-4-yl]piperidin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)CCN(c3ccc(N4CCC(C5CCN(c6ccc([N+](=O)[O-])cc6)CC5)CC4)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C35H41N5O5/c1-25-23-31(9-12-33(25)38-22-17-34(41)39(35(38)42)24-26-3-10-32(45-2)11-4-26)37-20-15-28(16-21-37)27-13-18-36(19-14-27)29-5-7-30(8-6-29)40(43)44/h3-12,23,27-28H,13-22,24H2,1-2H3 |
| InChIKey | ZHASBAFDQWRBOW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 99.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|