C29H38N4O3 — CID 177363693
1-[4-[4-(3-ethylcyclobutyl)piperazin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 177363693) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 1-[4-[4-(3-ethylcyclobutyl)piperazin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-(3-ethylcyclobutyl)piperazin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177363693 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 1-[4-[4-(3-ethylcyclobutyl)piperazin-1-yl]-2-methylphenyl]-3-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | CCC1CC(N2CCN(c3ccc(N4CCC(=O)N(Cc5ccc(OC)cc5)C4=O)c(C)c3)CC2)C1 |
| InChI | InChI=1S/C29H38N4O3/c1-4-22-18-25(19-22)31-15-13-30(14-16-31)24-7-10-27(21(2)17-24)32-12-11-28(34)33(29(32)35)20-23-5-8-26(36-3)9-6-23/h5-10,17,22,25H,4,11-16,18-20H2,1-3H3 |
| InChIKey | SSYLDXSDGDXKPX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|