C32H45N5O6 — CID 170572900
N-[3-[4-[3-(dimethylamino)-4-[(2,6-dioxopiperidin-3-yl)-formylamino]phenyl]but-3-ynoxy]-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)pentyl]formamide (PubChem CID 170572900) has the molecular formula C32H45N5O6 and a molecular weight of 595.74 g/mol. Its IUPAC name is N-[3-[4-[3-(dimethylamino)-4-[(2,6-dioxopiperidin-3-yl)-formylamino]phenyl]but-3-ynoxy]-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)pentyl]formamide.
| Compound Name | N-[3-[4-[3-(dimethylamino)-4-[(2,6-dioxopiperidin-3-yl)-formylamino]phenyl]but-3-ynoxy]-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)pentyl]formamide |
|---|---|
| PubChem CID | 170572900 |
| Molecular Formula | C32H45N5O6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | N-[3-[4-[3-(dimethylamino)-4-[(2,6-dioxopiperidin-3-yl)-formylamino]phenyl]but-3-ynoxy]-5-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)pentyl]formamide |
| SMILES | CN(C)c1cc(C#CCCOC(CCNC=O)CCOCC2CCC3CCCN32)ccc1N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C32H45N5O6/c1-35(2)30-20-24(8-11-28(30)37(23-39)29-12-13-31(40)34-32(29)41)6-3-4-18-43-27(14-16-33-22-38)15-19-42-21-26-10-9-25-7-5-17-36(25)26/h8,11,20,22-23,25-27,29H,4-5,7,9-10,12-19,21H2,1-2H3,(H,33,38)(H,34,40,41) |
| InChIKey | MIJUZIWZJNMSQH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|