C32H43N5O5 — CID 156882596
3-[4-[2-[[4-[[(Z,2E)-5-amino-2-ethylidenepent-3-enoyl]amino]cyclohexyl]amino]ethoxy]but-1-ynyl]-N-(2,6-dioxopiperidin-3-yl)-N-methylbenzamide (PubChem CID 156882596) has the molecular formula C32H43N5O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is 3-[4-[2-[[4-[[(Z,2E)-5-amino-2-ethylidenepent-3-enoyl]amino]cyclohexyl]amino]ethoxy]but-1-ynyl]-N-(2,6-dioxopiperidin-3-yl)-N-methylbenzamide.
| Compound Name | 3-[4-[2-[[4-[[(Z,2E)-5-amino-2-ethylidenepent-3-enoyl]amino]cyclohexyl]amino]ethoxy]but-1-ynyl]-N-(2,6-dioxopiperidin-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 156882596 |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | 3-[4-[2-[[4-[[(Z,2E)-5-amino-2-ethylidenepent-3-enoyl]amino]cyclohexyl]amino]ethoxy]but-1-ynyl]-N-(2,6-dioxopiperidin-3-yl)-N-methylbenzamide |
| SMILES | C/C=C(\C=C/CN)C(=O)NC1CCC(NCCOCCC#Cc2cccc(C(=O)N(C)C3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C32H43N5O5/c1-3-24(11-7-18-33)30(39)35-27-14-12-26(13-15-27)34-19-21-42-20-5-4-8-23-9-6-10-25(22-23)32(41)37(2)28-16-17-29(38)36-31(28)40/h3,6-7,9-11,22,26-28,34H,5,12-21,33H2,1-2H3,(H,35,39)(H,36,38,40)/b11-7-,24-3+ |
| InChIKey | KIFIPTWKCYEQGO-XDJJADGOSA-N |
| XLogP | 1.80 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|