C33H36N4O4 — CID 174288854
3-[6-[(3S)-1-[(2-cyclohexylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174288854) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[6-[(3S)-1-[(2-cyclohexylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-[(2-cyclohexylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174288854 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-[6-[(3S)-1-[(2-cyclohexylquinolin-6-yl)methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCN(Cc5ccc6nc(C7CCCCC7)ccc6c5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H36N4O4/c38-31-13-12-30(32(39)35-31)37-19-24-17-25(8-9-27(24)33(37)40)41-26-14-15-36(20-26)18-21-6-10-29-23(16-21)7-11-28(34-29)22-4-2-1-3-5-22/h6-11,16-17,22,26,30H,1-5,12-15,18-20H2,(H,35,38,39)/t26-,30?/m0/s1 |
| InChIKey | LGMQTIXBXKPRNJ-PKMDPOOCSA-N |
| XLogP | 4.70 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|